About N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide
N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide (PubChem CID 22954151) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide |
| PubChem CID | 22954151 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)CC(N)=O |
| InChI | InChI=1S/C7H14N2O2/c1-5(2)7(11)9(3)4-6(8)10/h5H,4H2,1-3H3,(H2,8,10) |
| InChIKey | KKVSLCQIRQWHHR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide (CID 22954151) is N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide is CC(C)C(=O)N(C)CC(N)=O.
What is the InChIKey of N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide?
The InChIKey is KKVSLCQIRQWHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-5(2)7(11)9(3)4-6(8)10/h5H,4H2,1-3H3,(H2,8,10).
What are the key properties of N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide?
N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide has a molecular weight of 158.20 g/mol, XLogP of -0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-N,2-dimethylpropanamide is sourced from PubChem (CID 22954151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).