C14H6N2O2S2 — CID 22954282
5,10-dioxo-4a,10a-dihydrobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile (PubChem CID 22954282) has the molecular formula C14H6N2O2S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5,10-dioxo-4a,10a-dihydrobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile.
| Compound Name | 5,10-dioxo-4a,10a-dihydrobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 22954282 |
| Molecular Formula | C14H6N2O2S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 5,10-dioxo-4a,10a-dihydrobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile |
| SMILES | N#CC1=C(C#N)SC2C(=O)c3ccccc3C(=O)C2S1 |
| InChI | InChI=1S/C14H6N2O2S2/c15-5-9-10(6-16)20-14-12(18)8-4-2-1-3-7(8)11(17)13(14)19-9/h1-4,13-14H |
| InChIKey | GYJUTQDVFUWUAH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|