About N'-hydroxy-N,N-dimethylethanimidamide;yttrium
N'-hydroxy-N,N-dimethylethanimidamide;yttrium (PubChem CID 22954408) has the molecular formula C4H10N2OY
and a molecular weight of 191.04 g/mol. Its IUPAC name is N'-hydroxy-N,N-dimethylethanimidamide;yttrium.
Molecular Properties
| Compound Name | N'-hydroxy-N,N-dimethylethanimidamide;yttrium |
| PubChem CID | 22954408 |
| Molecular Formula | C4H10N2OY |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | N'-hydroxy-N,N-dimethylethanimidamide;yttrium |
| SMILES | C/C(=N/O)N(C)C.[Y] |
| InChI | InChI=1S/C4H10N2O.Y/c1-4(5-7)6(2)3;/h7H,1-3H3;/b5-4-; |
| InChIKey | QVMHOXNEKBCMMN-MKWAYWHRSA-N |
| XLogP | 0.35 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-N,N-dimethylethanimidamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-N,N-dimethylethanimidamide;yttrium?
The IUPAC name of N'-hydroxy-N,N-dimethylethanimidamide;yttrium (CID 22954408) is N'-hydroxy-N,N-dimethylethanimidamide;yttrium.
What is the SMILES notation for N'-hydroxy-N,N-dimethylethanimidamide;yttrium?
The canonical SMILES for N'-hydroxy-N,N-dimethylethanimidamide;yttrium is C/C(=N/O)N(C)C.[Y].
What is the InChIKey of N'-hydroxy-N,N-dimethylethanimidamide;yttrium?
The InChIKey is QVMHOXNEKBCMMN-MKWAYWHRSA-N. The full InChI is InChI=1S/C4H10N2O.Y/c1-4(5-7)6(2)3;/h7H,1-3H3;/b5-4-;.
What are the key properties of N'-hydroxy-N,N-dimethylethanimidamide;yttrium?
N'-hydroxy-N,N-dimethylethanimidamide;yttrium has a molecular weight of 191.04 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-N,N-dimethylethanimidamide;yttrium is sourced from PubChem (CID 22954408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).