About 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine
5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine (PubChem CID 22954785) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine.
Analyze 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine?
The IUPAC name of 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine (CID 22954785) is 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine.
What is the SMILES notation for 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine?
The canonical SMILES for 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine is CC1CC2=C(CN1C)N=CC2.
What is the InChIKey of 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine?
The InChIKey is PJWYNLIYFXJODQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7-5-8-3-4-10-9(8)6-11(7)2/h4,7H,3,5-6H2,1-2H3.
What are the key properties of 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine?
5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine has a molecular weight of 150.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3,4,5,7-tetrahydropyrrolo[2,3-c]pyridine is sourced from PubChem (CID 22954785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).