About 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol
2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol (PubChem CID 22955480) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol.
Molecular Properties
| Compound Name | 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol |
| PubChem CID | 22955480 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol |
| SMILES | CCC(C)C(C)CNC(CO)C(C)CC |
| InChI | InChI=1S/C13H29NO/c1-6-10(3)12(5)8-14-13(9-15)11(4)7-2/h10-15H,6-9H2,1-5H3 |
| InChIKey | GYWIFQYPBLVKPM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol?
The IUPAC name of 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol (CID 22955480) is 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol.
What is the SMILES notation for 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol?
The canonical SMILES for 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol is CCC(C)C(C)CNC(CO)C(C)CC.
What is the InChIKey of 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol?
The InChIKey is GYWIFQYPBLVKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO/c1-6-10(3)12(5)8-14-13(9-15)11(4)7-2/h10-15H,6-9H2,1-5H3.
What are the key properties of 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol?
2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol has a molecular weight of 215.38 g/mol, XLogP of 2.67, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylpentylamino)-3-methylpentan-1-ol is sourced from PubChem (CID 22955480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).