C17H24N7O5S+ — CID 22955553
3-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 22955553) has the molecular formula C17H24N7O5S+ and a molecular weight of 438.49 g/mol. Its IUPAC name is 3-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22955553 |
| Molecular Formula | C17H24N7O5S+ |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 3-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CCS(=O)(=O)NC1C[N+]1(C)c1nc(NCCO)nc(Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C17H23N7O5S/c1-3-30(28,29)23-13-10-24(13,2)17-21-15(18-7-8-25)20-16(22-17)19-12-6-4-5-11(9-12)14(26)27/h4-6,9,13,23,25H,3,7-8,10H2,1-2H3,(H2-,18,19,20,21,22,26,27)/p+1 |
| InChIKey | FBYPNAUJROAVKN-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|