C17H24N7O7S2+ — CID 22955557
4-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 22955557) has the molecular formula C17H24N7O7S2+ and a molecular weight of 502.56 g/mol. Its IUPAC name is 4-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22955557 |
| Molecular Formula | C17H24N7O7S2+ |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 4-[[4-[2-(ethylsulfonylamino)-1-methylaziridin-1-ium-1-yl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CCS(=O)(=O)NC1C[N+]1(C)c1nc(NCCS(=O)(=O)O)nc(Nc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C17H23N7O7S2/c1-3-32(27,28)23-13-10-24(13,2)17-21-15(18-8-9-33(29,30)31)20-16(22-17)19-12-6-4-11(5-7-12)14(25)26/h4-7,13,23H,3,8-10H2,1-2H3,(H3-,18,19,20,21,22,25,26,29,30,31)/p+1 |
| InChIKey | RVHXUZGAYSQHSN-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 200.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|