About 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium
3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium (PubChem CID 22955602) has the molecular formula C18H36N3O2+
and a molecular weight of 326.51 g/mol. Its IUPAC name is 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium.
Molecular Properties
| Compound Name | 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium |
| PubChem CID | 22955602 |
| Molecular Formula | C18H36N3O2+ |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium |
| SMILES | CCC(CC(C)(C)C(=O)NCCC[N+](C)(C)C)N1CCCC1=O |
| InChI | InChI=1S/C18H35N3O2/c1-7-15(20-12-8-10-16(20)22)14-18(2,3)17(23)19-11-9-13-21(4,5)6/h15H,7-14H2,1-6H3/p+1 |
| InChIKey | OGDRVSHRQJIWPU-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium?
The IUPAC name of 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium (CID 22955602) is 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium.
What is the SMILES notation for 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium?
The canonical SMILES for 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium is CCC(CC(C)(C)C(=O)NCCC[N+](C)(C)C)N1CCCC1=O.
What is the InChIKey of 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium?
The InChIKey is OGDRVSHRQJIWPU-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H35N3O2/c1-7-15(20-12-8-10-16(20)22)14-18(2,3)17(23)19-11-9-13-21(4,5)6/h15H,7-14H2,1-6H3/p+1.
What are the key properties of 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium?
3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium has a molecular weight of 326.51 g/mol, XLogP of 2.02, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]amino]propyl-trimethylazanium is sourced from PubChem (CID 22955602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).