C30H33F3N4O2 — CID 22955850
[2-(1-ethylbenzimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22955850) has the molecular formula C30H33F3N4O2 and a molecular weight of 538.61 g/mol. Its IUPAC name is [2-(1-ethylbenzimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | [2-(1-ethylbenzimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22955850 |
| Molecular Formula | C30H33F3N4O2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [2-(1-ethylbenzimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OC(Cc2nc3ccccc3n2CC)c2cccc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C30H33F3N4O2/c1-5-36(6-2)23-15-16-24(20(4)17-23)35-29(38)39-27(21-11-10-12-22(18-21)30(31,32)33)19-28-34-25-13-8-9-14-26(25)37(28)7-3/h8-18,27H,5-7,19H2,1-4H3,(H,35,38) |
| InChIKey | KHEZLKUTKMMELW-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|