About trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane
trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane (PubChem CID 22956603) has the molecular formula C7H9Cl3Si
and a molecular weight of 227.59 g/mol. Its IUPAC name is trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane.
Molecular Properties
| Compound Name | trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane |
| PubChem CID | 22956603 |
| Molecular Formula | C7H9Cl3Si |
| Molecular Weight | 227.59 g/mol |
| Exact Mass | 225.95 |
| IUPAC Name | trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane |
| SMILES | Cl[Si](Cl)(Cl)C1C2CC3C(C2)C31 |
| InChI | InChI=1S/C7H9Cl3Si/c8-11(9,10)7-3-1-4-5(2-3)6(4)7/h3-7H,1-2H2 |
| InChIKey | SVXFXECCHGDTHK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane?
The IUPAC name of trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane (CID 22956603) is trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane.
What is the SMILES notation for trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane?
The canonical SMILES for trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane is Cl[Si](Cl)(Cl)C1C2CC3C(C2)C31.
What is the InChIKey of trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane?
The InChIKey is SVXFXECCHGDTHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl3Si/c8-11(9,10)7-3-1-4-5(2-3)6(4)7/h3-7H,1-2H2.
What are the key properties of trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane?
trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane has a molecular weight of 227.59 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(3-tricyclo[2.2.1.02,6]heptanyl)silane is sourced from PubChem (CID 22956603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).