C9H7IO — CID 22956884
bicyclo[4.2.0]octa-1,3,5-triene-7-carbonyl iodide (PubChem CID 22956884) has the molecular formula C9H7IO and a molecular weight of 258.06 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-triene-7-carbonyl iodide.
| Compound Name | bicyclo[4.2.0]octa-1,3,5-triene-7-carbonyl iodide |
|---|---|
| PubChem CID | 22956884 |
| Molecular Formula | C9H7IO |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-triene-7-carbonyl iodide |
| SMILES | O=C(I)C1Cc2ccccc21 |
| InChI | InChI=1S/C9H7IO/c10-9(11)8-5-6-3-1-2-4-7(6)8/h1-4,8H,5H2 |
| InChIKey | DGNFINLECJHSSS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|