C36H32F3N5O7 — CID 22956928
(3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-(quinoline-2-carbonyl)piperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 22956928) has the molecular formula C36H32F3N5O7 and a molecular weight of 703.67 g/mol. Its IUPAC name is (3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-(quinoline-2-carbonyl)piperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-(quinoline-2-carbonyl)piperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22956928 |
| Molecular Formula | C36H32F3N5O7 |
| Molecular Weight | 703.67 g/mol |
| Exact Mass | 703.23 |
| IUPAC Name | (3R,4S)-3-N-hydroxy-4-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1-(quinoline-2-carbonyl)piperidine-3,4-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(COc2ccc(NC(=O)[C@H]3CCN(C(=O)c4ccc5ccccc5n4)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H31N5O5.C2HF3O2/c1-21-18-23(26-7-3-5-9-30(26)35-21)20-44-25-13-11-24(12-14-25)36-32(40)27-16-17-39(19-28(27)33(41)38-43)34(42)31-15-10-22-6-2-4-8-29(22)37-31;3-2(4,5)1(6)7/h2-15,18,27-28,43H,16-17,19-20H2,1H3,(H,36,40)(H,38,41);(H,6,7)/t27-,28-;/m0./s1 |
| InChIKey | YLTOXFWQHLRSMQ-DHBRAOIWSA-N |
| XLogP | 5.53 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|