C14H14N4O4S2 — CID 2295719
methyl 4-[[2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 2295719) has the molecular formula C14H14N4O4S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl 4-[[2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2295719 |
| Molecular Formula | C14H14N4O4S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | methyl 4-[[2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2nnc(NC(C)=O)s2)cc1 |
| InChI | InChI=1S/C14H14N4O4S2/c1-8(19)15-13-17-18-14(24-13)23-7-11(20)16-10-5-3-9(4-6-10)12(21)22-2/h3-6H,7H2,1-2H3,(H,16,20)(H,15,17,19) |
| InChIKey | IAOSUOVHHDOVPF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|