About 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate
2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate (PubChem CID 22957359) has the molecular formula C7H5O3-
and a molecular weight of 137.11 g/mol. Its IUPAC name is 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate.
Molecular Properties
| Compound Name | 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate |
| PubChem CID | 22957359 |
| Molecular Formula | C7H5O3- |
| Molecular Weight | 137.11 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate |
| SMILES | C=C1C(=O)C(=O)C(C)=C1[O-] |
| InChI | InChI=1S/C7H6O3/c1-3-5(8)4(2)7(10)6(3)9/h8H,1H2,2H3/p-1 |
| InChIKey | KVFAOOBXDVHICV-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.11 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate?
The IUPAC name of 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate (CID 22957359) is 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate.
What is the SMILES notation for 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate?
The canonical SMILES for 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate is C=C1C(=O)C(=O)C(C)=C1[O-].
What is the InChIKey of 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate?
The InChIKey is KVFAOOBXDVHICV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3/c1-3-5(8)4(2)7(10)6(3)9/h8H,1H2,2H3/p-1.
What are the key properties of 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate?
2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate has a molecular weight of 137.11 g/mol, XLogP of -0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-methylidene-3,4-dioxocyclopenten-1-olate is sourced from PubChem (CID 22957359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).