C44H44N4O4 — CID 22957564
4-[[26,27,28-tris(3-cyanopropoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl]oxy]butanenitrile (PubChem CID 22957564) has the molecular formula C44H44N4O4 and a molecular weight of 692.86 g/mol. Its IUPAC name is 4-[[26,27,28-tris(3-cyanopropoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl]oxy]butanenitrile.
| Compound Name | 4-[[26,27,28-tris(3-cyanopropoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl]oxy]butanenitrile |
|---|---|
| PubChem CID | 22957564 |
| Molecular Formula | C44H44N4O4 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 4-[[26,27,28-tris(3-cyanopropoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl]oxy]butanenitrile |
| SMILES | N#CCCCOc1c2cccc1Cc1cccc(c1OCCCC#N)Cc1cccc(c1OCCCC#N)Cc1cccc(c1OCCCC#N)C2 |
| InChI | InChI=1S/C44H44N4O4/c45-21-1-5-25-49-41-33-13-9-14-34(41)30-36-16-11-18-38(43(36)51-27-7-3-23-47)32-40-20-12-19-39(44(40)52-28-8-4-24-48)31-37-17-10-15-35(29-33)42(37)50-26-6-2-22-46/h9-20H,1-8,25-32H2 |
| InChIKey | VVEKKZGVTQTFGA-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|