C14H16N2O — CID 2295787
2-N-(2-phenoxyethyl)benzene-1,2-diamine (PubChem CID 2295787) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-N-(2-phenoxyethyl)benzene-1,2-diamine.
| Compound Name | 2-N-(2-phenoxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 2295787 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-N-(2-phenoxyethyl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1NCCOc1ccccc1 |
| InChI | InChI=1S/C14H16N2O/c15-13-8-4-5-9-14(13)16-10-11-17-12-6-2-1-3-7-12/h1-9,16H,10-11,15H2 |
| InChIKey | PYRLCNHZSHDZFM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|