About 2-(4-methyl-5,6-dioxoheptyl)guanidine
2-(4-methyl-5,6-dioxoheptyl)guanidine (PubChem CID 22957966) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(4-methyl-5,6-dioxoheptyl)guanidine.
Molecular Properties
| Compound Name | 2-(4-methyl-5,6-dioxoheptyl)guanidine |
| PubChem CID | 22957966 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-(4-methyl-5,6-dioxoheptyl)guanidine |
| SMILES | CC(=O)C(=O)C(C)CCCN=C(N)N |
| InChI | InChI=1S/C9H17N3O2/c1-6(8(14)7(2)13)4-3-5-12-9(10)11/h6H,3-5H2,1-2H3,(H4,10,11,12) |
| InChIKey | BCQSLNRBIZVUJK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-5,6-dioxoheptyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-5,6-dioxoheptyl)guanidine?
The IUPAC name of 2-(4-methyl-5,6-dioxoheptyl)guanidine (CID 22957966) is 2-(4-methyl-5,6-dioxoheptyl)guanidine.
What is the SMILES notation for 2-(4-methyl-5,6-dioxoheptyl)guanidine?
The canonical SMILES for 2-(4-methyl-5,6-dioxoheptyl)guanidine is CC(=O)C(=O)C(C)CCCN=C(N)N.
What is the InChIKey of 2-(4-methyl-5,6-dioxoheptyl)guanidine?
The InChIKey is BCQSLNRBIZVUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-6(8(14)7(2)13)4-3-5-12-9(10)11/h6H,3-5H2,1-2H3,(H4,10,11,12).
What are the key properties of 2-(4-methyl-5,6-dioxoheptyl)guanidine?
2-(4-methyl-5,6-dioxoheptyl)guanidine has a molecular weight of 199.25 g/mol, XLogP of -0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-5,6-dioxoheptyl)guanidine is sourced from PubChem (CID 22957966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).