C12H18N2 — CID 22958180
1,2,3,4,4a,5,6,6a,10a,10b-decahydro-1,10-phenanthroline (PubChem CID 22958180) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,6a,10a,10b-decahydro-1,10-phenanthroline.
| Compound Name | 1,2,3,4,4a,5,6,6a,10a,10b-decahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 22958180 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1,2,3,4,4a,5,6,6a,10a,10b-decahydro-1,10-phenanthroline |
| SMILES | C1=CC2CCC3CCCNC3C2N=C1 |
| InChI | InChI=1S/C12H18N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1,3,7,9-12,14H,2,4-6,8H2 |
| InChIKey | ZQDWCSLSYOUOKB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |