About 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol
4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol (PubChem CID 2295868) has the molecular formula C17H12N2OS2
and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol |
| PubChem CID | 2295868 |
| Molecular Formula | C17H12N2OS2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol |
| SMILES | Oc1ccc(-c2nc(-c3cccs3)c(-c3cccs3)[nH]2)cc1 |
| InChI | InChI=1S/C17H12N2OS2/c20-12-7-5-11(6-8-12)17-18-15(13-3-1-9-21-13)16(19-17)14-4-2-10-22-14/h1-10,20H,(H,18,19) |
| InChIKey | UAMYPYGPRIESDG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol?
The IUPAC name of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol (CID 2295868) is 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol.
What is the SMILES notation for 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol?
The canonical SMILES for 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol is Oc1ccc(-c2nc(-c3cccs3)c(-c3cccs3)[nH]2)cc1.
What is the InChIKey of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol?
The InChIKey is UAMYPYGPRIESDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2OS2/c20-12-7-5-11(6-8-12)17-18-15(13-3-1-9-21-13)16(19-17)14-4-2-10-22-14/h1-10,20H,(H,18,19).
What are the key properties of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol?
4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol has a molecular weight of 324.43 g/mol, XLogP of 5.24, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)phenol is sourced from PubChem (CID 2295868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).