C24H36ClN5O2S — CID 22958728
N-[2-[3-[(3-chlorophenyl)methyl]imidazol-4-yl]ethyl]-4-hexyl-1-methylsulfinylpiperazine-2-carboxamide (PubChem CID 22958728) has the molecular formula C24H36ClN5O2S and a molecular weight of 494.11 g/mol. Its IUPAC name is N-[2-[3-[(3-chlorophenyl)methyl]imidazol-4-yl]ethyl]-4-hexyl-1-methylsulfinylpiperazine-2-carboxamide.
| Compound Name | N-[2-[3-[(3-chlorophenyl)methyl]imidazol-4-yl]ethyl]-4-hexyl-1-methylsulfinylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 22958728 |
| Molecular Formula | C24H36ClN5O2S |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[2-[3-[(3-chlorophenyl)methyl]imidazol-4-yl]ethyl]-4-hexyl-1-methylsulfinylpiperazine-2-carboxamide |
| SMILES | CCCCCCN1CCN(S(C)=O)C(C(=O)NCCc2cncn2Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C24H36ClN5O2S/c1-3-4-5-6-12-28-13-14-30(33(2)32)23(18-28)24(31)27-11-10-22-16-26-19-29(22)17-20-8-7-9-21(25)15-20/h7-9,15-16,19,23H,3-6,10-14,17-18H2,1-2H3,(H,27,31) |
| InChIKey | GUPDAIMFJFZYAY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|