C13H28N2O — CID 22958968
3-(diethylamino)-N,N-di(propan-2-yl)propanamide (PubChem CID 22958968) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-(diethylamino)-N,N-di(propan-2-yl)propanamide.
| Compound Name | 3-(diethylamino)-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 22958968 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 3-(diethylamino)-N,N-di(propan-2-yl)propanamide |
| SMILES | CCN(CC)CCC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H28N2O/c1-7-14(8-2)10-9-13(16)15(11(3)4)12(5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | AQQCWHALWRQEGF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |