About 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine
7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine (PubChem CID 22959166) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine.
Molecular Properties
| Compound Name | 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine |
| PubChem CID | 22959166 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine |
| SMILES | C=C1C=CCN=C(C(C)C)N1 |
| InChI | InChI=1S/C9H14N2/c1-7(2)9-10-6-4-5-8(3)11-9/h4-5,7H,3,6H2,1-2H3,(H,10,11) |
| InChIKey | GFNQTIPHRBRMHW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine?
The IUPAC name of 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine (CID 22959166) is 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine.
What is the SMILES notation for 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine?
The canonical SMILES for 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine is C=C1C=CCN=C(C(C)C)N1.
What is the InChIKey of 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine?
The InChIKey is GFNQTIPHRBRMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7(2)9-10-6-4-5-8(3)11-9/h4-5,7H,3,6H2,1-2H3,(H,10,11).
What are the key properties of 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine?
7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine has a molecular weight of 150.22 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-2-propan-2-yl-1,4-dihydro-1,3-diazepine is sourced from PubChem (CID 22959166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).