About 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine
3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine (PubChem CID 22959176) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine |
| PubChem CID | 22959176 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine |
| SMILES | C=C1C=C(C(C)C)C(=C)CN1 |
| InChI | InChI=1S/C10H15N/c1-7(2)10-5-9(4)11-6-8(10)3/h5,7,11H,3-4,6H2,1-2H3 |
| InChIKey | YNRMASVGVYGYFJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine?
The IUPAC name of 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine (CID 22959176) is 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine.
What is the SMILES notation for 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine?
The canonical SMILES for 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine is C=C1C=C(C(C)C)C(=C)CN1.
What is the InChIKey of 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine?
The InChIKey is YNRMASVGVYGYFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-7(2)10-5-9(4)11-6-8(10)3/h5,7,11H,3-4,6H2,1-2H3.
What are the key properties of 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine?
3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine has a molecular weight of 149.24 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylidene-4-propan-2-yl-1,2-dihydropyridine is sourced from PubChem (CID 22959176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).