About cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane
cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane (PubChem CID 22959373) has the molecular formula C11H19P
and a molecular weight of 182.25 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane.
Molecular Properties
| Compound Name | cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane |
| PubChem CID | 22959373 |
| Molecular Formula | C11H19P |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane |
| SMILES | CC(C)P(C1=CCC=C1)C(C)C |
| InChI | InChI=1S/C11H19P/c1-9(2)12(10(3)4)11-7-5-6-8-11/h5,7-10H,6H2,1-4H3 |
| InChIKey | PVOZOEVMVWBHIV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane?
The IUPAC name of cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane (CID 22959373) is cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane.
What is the SMILES notation for cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane?
The canonical SMILES for cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane is CC(C)P(C1=CCC=C1)C(C)C.
What is the InChIKey of cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane?
The InChIKey is PVOZOEVMVWBHIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19P/c1-9(2)12(10(3)4)11-7-5-6-8-11/h5,7-10H,6H2,1-4H3.
What are the key properties of cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane?
cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane has a molecular weight of 182.25 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,4-dien-1-yl-di(propan-2-yl)phosphane is sourced from PubChem (CID 22959373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).