C11H22N2O — CID 22959831
2-tert-butyl-3,5,6-trimethyl-1,3-diazinan-4-one (PubChem CID 22959831) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-tert-butyl-3,5,6-trimethyl-1,3-diazinan-4-one.
| Compound Name | 2-tert-butyl-3,5,6-trimethyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 22959831 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-tert-butyl-3,5,6-trimethyl-1,3-diazinan-4-one |
| SMILES | CC1NC(C(C)(C)C)N(C)C(=O)C1C |
| InChI | InChI=1S/C11H22N2O/c1-7-8(2)12-10(11(3,4)5)13(6)9(7)14/h7-8,10,12H,1-6H3 |
| InChIKey | SIUDHOPFIIPWER-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |