C6H12N3S+ — CID 22960008
N,N,4,5-tetramethyl-1,3,4-thiadiazol-4-ium-2-amine (PubChem CID 22960008) has the molecular formula C6H12N3S+ and a molecular weight of 158.25 g/mol. Its IUPAC name is N,N,4,5-tetramethyl-1,3,4-thiadiazol-4-ium-2-amine.
| Compound Name | N,N,4,5-tetramethyl-1,3,4-thiadiazol-4-ium-2-amine |
|---|---|
| PubChem CID | 22960008 |
| Molecular Formula | C6H12N3S+ |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | N,N,4,5-tetramethyl-1,3,4-thiadiazol-4-ium-2-amine |
| SMILES | Cc1sc(N(C)C)n[n+]1C |
| InChI | InChI=1S/C6H12N3S/c1-5-9(4)7-6(10-5)8(2)3/h1-4H3/q+1 |
| InChIKey | BYYZHXOGJAMIHO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|