About [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane
[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane (PubChem CID 22960067) has the molecular formula C8H19F3O2Si2
and a molecular weight of 260.40 g/mol. Its IUPAC name is [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane.
Molecular Properties
| Compound Name | [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane |
| PubChem CID | 22960067 |
| Molecular Formula | C8H19F3O2Si2 |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane |
| SMILES | CO[Si](C)(C)O[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C8H19F3O2Si2/c1-12-15(4,5)13-14(2,3)7-6-8(9,10)11/h6-7H2,1-5H3 |
| InChIKey | SLAHAXOWGFGUGU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane?
The IUPAC name of [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane (CID 22960067) is [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane.
What is the SMILES notation for [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane?
The canonical SMILES for [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane is CO[Si](C)(C)O[Si](C)(C)CCC(F)(F)F.
What is the InChIKey of [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane?
The InChIKey is SLAHAXOWGFGUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19F3O2Si2/c1-12-15(4,5)13-14(2,3)7-6-8(9,10)11/h6-7H2,1-5H3.
What are the key properties of [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane?
[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane has a molecular weight of 260.40 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methoxy-dimethylsilane is sourced from PubChem (CID 22960067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).