C42H24N6O3 — CID 22960120
2-[4-[4,6-bis[4-(1,3-benzoxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 22960120) has the molecular formula C42H24N6O3 and a molecular weight of 660.69 g/mol. Its IUPAC name is 2-[4-[4,6-bis[4-(1,3-benzoxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4,6-bis[4-(1,3-benzoxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 22960120 |
| Molecular Formula | C42H24N6O3 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 2-[4-[4,6-bis[4-(1,3-benzoxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(-c4nc(-c5ccc(-c6nc7ccccc7o6)cc5)nc(-c5ccc(-c6nc7ccccc7o6)cc5)n4)cc3)nc2c1 |
| InChI | InChI=1S/C42H24N6O3/c1-4-10-34-31(7-1)43-40(49-34)28-19-13-25(14-20-28)37-46-38(26-15-21-29(22-16-26)41-44-32-8-2-5-11-35(32)50-41)48-39(47-37)27-17-23-30(24-18-27)42-45-33-9-3-6-12-36(33)51-42/h1-24H |
| InChIKey | QYVFINNYZZJKPV-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 116.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |