C42H43N12+ — CID 22960262
4-(1-methyl-3H-pyrrol-1-ium-2-yl)-5,10,11,16,17-pentakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene (PubChem CID 22960262) has the molecular formula C42H43N12+ and a molecular weight of 715.89 g/mol. Its IUPAC name is 4-(1-methyl-3H-pyrrol-1-ium-2-yl)-5,10,11,16,17-pentakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene.
| Compound Name | 4-(1-methyl-3H-pyrrol-1-ium-2-yl)-5,10,11,16,17-pentakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene |
|---|---|
| PubChem CID | 22960262 |
| Molecular Formula | C42H43N12+ |
| Molecular Weight | 715.89 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | 4-(1-methyl-3H-pyrrol-1-ium-2-yl)-5,10,11,16,17-pentakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene |
| SMILES | Cn1cccc1C1N=c2c(c3c(c4c2=NC(c2cccn2C)C(c2cccn2C)N=4)=NC(c2cccn2C)C(c2cccn2C)N=3)=NC1C1=[N+](C)C=CC1 |
| InChI | InChI=1S/C42H43N12/c1-49-19-7-13-25(49)31-32(26-14-8-20-50(26)2)44-38-37(43-31)39-41(47-34(28-16-10-22-52(28)4)33(45-39)27-15-9-21-51(27)3)42-40(38)46-35(29-17-11-23-53(29)5)36(48-42)30-18-12-24-54(30)6/h7-17,19-24,31-36H,18H2,1-6H3/q+1 |
| InChIKey | KZQXSKGAIBKKBK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|