C44H54N4O2-2 — CID 22960287
2,4-bis(4'-tert-butylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)cyclobutane-1,3-diolate (PubChem CID 22960287) has the molecular formula C44H54N4O2-2 and a molecular weight of 670.94 g/mol. Its IUPAC name is 2,4-bis(4'-tert-butylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis(4'-tert-butylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 22960287 |
| Molecular Formula | C44H54N4O2-2 |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 670.43 |
| IUPAC Name | 2,4-bis(4'-tert-butylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)cyclobutane-1,3-diolate |
| SMILES | CC(C)(C)C1CCC2(CC1)Nc1cccc3c(C4C([O-])C(c5ccc6c7c(cccc57)NC5(CCC(C(C)(C)C)CC5)N6)C4[O-])ccc(c13)N2 |
| InChI | InChI=1S/C44H54N4O2/c1-41(2,3)25-17-21-43(22-18-25)45-31-11-7-9-27-29(13-15-33(47-43)35(27)31)37-39(49)38(40(37)50)30-14-16-34-36-28(30)10-8-12-32(36)46-44(48-34)23-19-26(20-24-44)42(4,5)6/h7-16,25-26,37-40,45-48H,17-24H2,1-6H3/q-2 |
| InChIKey | BTUACPWKYOIFAI-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|