C15H18N2O4 — CID 2296042
5-[(4-ethoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 2296042) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-[(4-ethoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-ethoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2296042 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-[(4-ethoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(CC2C(=O)N(C)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-4-21-11-7-5-10(6-8-11)9-12-13(18)16(2)15(20)17(3)14(12)19/h5-8,12H,4,9H2,1-3H3 |
| InChIKey | OZMGRZQAHWQRRQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|