About 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine
3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine (PubChem CID 22960663) has the molecular formula C19H20F6N2O
and a molecular weight of 406.37 g/mol. Its IUPAC name is 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine |
| PubChem CID | 22960663 |
| Molecular Formula | C19H20F6N2O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine |
| SMILES | CC(OCC(N)(CN)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F6N2O/c1-12(28-11-17(27,10-26)14-5-3-2-4-6-14)13-7-15(18(20,21)22)9-16(8-13)19(23,24)25/h2-9,12H,10-11,26-27H2,1H3 |
| InChIKey | APTHQDJPCFCQNH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine?
The IUPAC name of 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine (CID 22960663) is 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine.
What is the SMILES notation for 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine?
The canonical SMILES for 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine is CC(OCC(N)(CN)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine?
The InChIKey is APTHQDJPCFCQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F6N2O/c1-12(28-11-17(27,10-26)14-5-3-2-4-6-14)13-7-15(18(20,21)22)9-16(8-13)19(23,24)25/h2-9,12H,10-11,26-27H2,1H3.
What are the key properties of 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine?
3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine has a molecular weight of 406.37 g/mol, XLogP of 4.61, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpropane-1,2-diamine is sourced from PubChem (CID 22960663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).