C13H17N5O5 — CID 22961572
1-(6-isocyanatohexyl)-3-(isocyanatomethyl)-5-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 22961572) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is 1-(6-isocyanatohexyl)-3-(isocyanatomethyl)-5-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(6-isocyanatohexyl)-3-(isocyanatomethyl)-5-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22961572 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-(6-isocyanatohexyl)-3-(isocyanatomethyl)-5-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(CCCCCCN=C=O)c(=O)n(CN=C=O)c1=O |
| InChI | InChI=1S/C13H17N5O5/c1-16-11(21)17(7-5-3-2-4-6-14-9-19)13(23)18(12(16)22)8-15-10-20/h2-8H2,1H3 |
| InChIKey | DYWAITIWOCHBAX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 124.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|