C29H24F3NO4S — CID 22961940
[3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 22961940) has the molecular formula C29H24F3NO4S and a molecular weight of 539.58 g/mol. Its IUPAC name is [3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22961940 |
| Molecular Formula | C29H24F3NO4S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | [3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc(C[C@@H]2CCCC=C2c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1)C(F)(F)F |
| InChI | InChI=1S/C29H24F3NO4S/c30-29(31,32)38(34,35)37-24-16-9-10-20(19-24)18-23-15-7-8-17-25(23)28-33-26(21-11-3-1-4-12-21)27(36-28)22-13-5-2-6-14-22/h1-6,9-14,16-17,19,23H,7-8,15,18H2/t23-/m0/s1 |
| InChIKey | NUZDHRSYTXCBFR-QHCPKHFHSA-N |
| XLogP | 7.66 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|