About [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane
[(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane (PubChem CID 22962113) has the molecular formula C14H24OSi
and a molecular weight of 236.43 g/mol. Its IUPAC name is [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane |
| PubChem CID | 22962113 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane |
| SMILES | CCOC/C=C/C/C=C/CC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-5-15-13-11-9-7-6-8-10-12-14-16(2,3)4/h6,8-9,11H,5,7,10,13H2,1-4H3/b8-6+,11-9+ |
| InChIKey | YCZYWWJVAWUQCD-ZOIFJEAISA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane?
The IUPAC name of [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane (CID 22962113) is [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane?
The canonical SMILES for [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane is CCOC/C=C/C/C=C/CC#C[Si](C)(C)C.
What is the InChIKey of [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane?
The InChIKey is YCZYWWJVAWUQCD-ZOIFJEAISA-N. The full InChI is InChI=1S/C14H24OSi/c1-5-15-13-11-9-7-6-8-10-12-14-16(2,3)4/h6,8-9,11H,5,7,10,13H2,1-4H3/b8-6+,11-9+.
What are the key properties of [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane?
[(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane has a molecular weight of 236.43 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E,7E)-9-ethoxynona-4,7-dien-1-ynyl]-trimethylsilane is sourced from PubChem (CID 22962113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).