C25H28F3NO4 — CID 22962509
(Z)-1-[3-[(E)-4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-enoxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 22962509) has the molecular formula C25H28F3NO4 and a molecular weight of 463.50 g/mol. Its IUPAC name is (Z)-1-[3-[(E)-4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-enoxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (Z)-1-[3-[(E)-4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-enoxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 22962509 |
| Molecular Formula | C25H28F3NO4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (Z)-1-[3-[(E)-4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-enoxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC/C=C/COc2cccc(/C(=N/OC)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C25H28F3NO4/c1-5-6-12-32-22-15-18(2)23(19(3)16-22)33-14-8-7-13-31-21-11-9-10-20(17-21)24(29-30-4)25(26,27)28/h5-11,15-17H,12-14H2,1-4H3/b6-5+,8-7+,29-24- |
| InChIKey | OYYUAGMIKORPOZ-GMMOIHINSA-N |
| XLogP | 6.19 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|