C23H24F5NO3 — CID 22962540
(Z)-1-[3-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]phenyl]-2,2,3,3,3-pentafluoro-N-methoxypropan-1-imine (PubChem CID 22962540) has the molecular formula C23H24F5NO3 and a molecular weight of 457.44 g/mol. Its IUPAC name is (Z)-1-[3-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]phenyl]-2,2,3,3,3-pentafluoro-N-methoxypropan-1-imine.
| Compound Name | (Z)-1-[3-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]phenyl]-2,2,3,3,3-pentafluoro-N-methoxypropan-1-imine |
|---|---|
| PubChem CID | 22962540 |
| Molecular Formula | C23H24F5NO3 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (Z)-1-[3-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]phenyl]-2,2,3,3,3-pentafluoro-N-methoxypropan-1-imine |
| SMILES | C/C=C/COc1cc(C)c(OCc2cccc(/C(=N/OC)C(F)(F)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C23H24F5NO3/c1-5-6-10-31-19-11-15(2)20(16(3)12-19)32-14-17-8-7-9-18(13-17)21(29-30-4)22(24,25)23(26,27)28/h5-9,11-13H,10,14H2,1-4H3/b6-5+,29-21- |
| InChIKey | QQOOFPZEQMMPQB-BEWLNUPSSA-N |
| XLogP | 6.39 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|