C21H24FNO3 — CID 22963107
(E)-2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-1-(4-fluorophenyl)-N-methoxyethanimine (PubChem CID 22963107) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is (E)-2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-1-(4-fluorophenyl)-N-methoxyethanimine.
| Compound Name | (E)-2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-1-(4-fluorophenyl)-N-methoxyethanimine |
|---|---|
| PubChem CID | 22963107 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (E)-2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-1-(4-fluorophenyl)-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC/C(=N/OC)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C21H24FNO3/c1-5-6-11-25-19-12-15(2)21(16(3)13-19)26-14-20(23-24-4)17-7-9-18(22)10-8-17/h5-10,12-13H,11,14H2,1-4H3/b6-5+,23-20- |
| InChIKey | LZBLMIIOPUKKNU-IXDNFEQWSA-N |
| XLogP | 4.83 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|