C23H38N2O3 — CID 22963231
5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-ethyl-N-[(2E)-2-methoxyiminopropyl]pentan-1-amine (PubChem CID 22963231) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is 5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-ethyl-N-[(2E)-2-methoxyiminopropyl]pentan-1-amine.
| Compound Name | 5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-ethyl-N-[(2E)-2-methoxyiminopropyl]pentan-1-amine |
|---|---|
| PubChem CID | 22963231 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-ethyl-N-[(2E)-2-methoxyiminopropyl]pentan-1-amine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCN(CC)C/C(C)=N/OC)c(C)c1 |
| InChI | InChI=1S/C23H38N2O3/c1-7-9-14-27-22-16-19(3)23(20(4)17-22)28-15-12-10-11-13-25(8-2)18-21(5)24-26-6/h7,9,16-17H,8,10-15,18H2,1-6H3/b9-7+,24-21+ |
| InChIKey | SQRJKTVULVZNQQ-WAUCBPOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|