C19H28FNO3 — CID 22963605
N-[3-(2,6-diethyl-3-fluoro-4-prop-2-enoxyphenoxy)propoxy]propan-2-imine (PubChem CID 22963605) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[3-(2,6-diethyl-3-fluoro-4-prop-2-enoxyphenoxy)propoxy]propan-2-imine.
| Compound Name | N-[3-(2,6-diethyl-3-fluoro-4-prop-2-enoxyphenoxy)propoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963605 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | N-[3-(2,6-diethyl-3-fluoro-4-prop-2-enoxyphenoxy)propoxy]propan-2-imine |
| SMILES | C=CCOc1cc(CC)c(OCCCON=C(C)C)c(CC)c1F |
| InChI | InChI=1S/C19H28FNO3/c1-6-10-22-17-13-15(7-2)19(16(8-3)18(17)20)23-11-9-12-24-21-14(4)5/h6,13H,1,7-12H2,2-5H3 |
| InChIKey | DASCADCAGUFRIJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|