About methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium
methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium (PubChem CID 22964140) has the molecular formula C5H2F6N+
and a molecular weight of 190.07 g/mol. Its IUPAC name is methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium.
Molecular Properties
| Compound Name | methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium |
| PubChem CID | 22964140 |
| Molecular Formula | C5H2F6N+ |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium |
| SMILES | C#[N+]C=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F6N/c1-12-2-3(4(6,7)8)5(9,10)11/h1-2H/q+1 |
| InChIKey | JHCXBPDNWHKEOX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium?
The IUPAC name of methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium (CID 22964140) is methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium.
What is the SMILES notation for methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium?
The canonical SMILES for methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium is C#[N+]C=C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium?
The InChIKey is JHCXBPDNWHKEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F6N/c1-12-2-3(4(6,7)8)5(9,10)11/h1-2H/q+1.
What are the key properties of methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium?
methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium has a molecular weight of 190.07 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylidyne-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]azanium is sourced from PubChem (CID 22964140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).