About CID 22964430
CID 22964430 (PubChem CID 22964430) has the molecular formula C30H57N5O4Si
and a molecular weight of 579.90 g/mol.
Molecular Properties
| Compound Name | CID 22964430 |
| PubChem CID | 22964430 |
| Molecular Formula | C30H57N5O4Si |
| Molecular Weight | 579.90 g/mol |
| Exact Mass | 579.42 |
| IUPAC Name | — |
| SMILES | CCO[Si]CCCNC(=O)N(CCN(CCNC)C(=O)CCCCCCCC1=CC(C)CC(C(C)=O)C1)C(C)N |
| InChI | InChI=1S/C30H57N5O4Si/c1-6-39-40-20-12-15-33-30(38)35(26(4)31)19-18-34(17-16-32-5)29(37)14-11-9-7-8-10-13-27-21-24(2)22-28(23-27)25(3)36/h21,24,26,28,32H,6-20,22-23,31H2,1-5H3,(H,33,38) |
| InChIKey | GFQAPKCXSNLTEB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 579.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 22964430 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22964430?
The IUPAC name of CID 22964430 (CID 22964430) is not available.
What is the SMILES notation for CID 22964430?
The canonical SMILES for CID 22964430 is CCO[Si]CCCNC(=O)N(CCN(CCNC)C(=O)CCCCCCCC1=CC(C)CC(C(C)=O)C1)C(C)N.
What is the InChIKey of CID 22964430?
The InChIKey is GFQAPKCXSNLTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H57N5O4Si/c1-6-39-40-20-12-15-33-30(38)35(26(4)31)19-18-34(17-16-32-5)29(37)14-11-9-7-8-10-13-27-21-24(2)22-28(23-27)25(3)36/h21,24,26,28,32H,6-20,22-23,31H2,1-5H3,(H,33,38).
What are the key properties of CID 22964430?
CID 22964430 has a molecular weight of 579.90 g/mol, XLogP of 4.11, 22 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22964430 is sourced from PubChem (CID 22964430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).