C17H29NO2 — CID 22964441
2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate (PubChem CID 22964441) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22964441 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=CC1CC(C)(C)N(CCOC(=O)C(=C)C)C(C)(C)C1 |
| InChI | InChI=1S/C17H29NO2/c1-8-14-11-16(4,5)18(17(6,7)12-14)9-10-20-15(19)13(2)3/h8,14H,1-2,9-12H2,3-7H3 |
| InChIKey | CXCNKQGICHIZAX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|