C14H23N3O3 — CID 22964484
3-(2,5-dioxopyrrol-1-yl)-N-[6-(methylamino)hexyl]propanamide (PubChem CID 22964484) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[6-(methylamino)hexyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[6-(methylamino)hexyl]propanamide |
|---|---|
| PubChem CID | 22964484 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[6-(methylamino)hexyl]propanamide |
| SMILES | CNCCCCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H23N3O3/c1-15-9-4-2-3-5-10-16-12(18)8-11-17-13(19)6-7-14(17)20/h6-7,15H,2-5,8-11H2,1H3,(H,16,18) |
| InChIKey | QTYYQXCWSBPHAM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|