About 2,5-dimethyl-1,3-diazinane
2,5-dimethyl-1,3-diazinane (PubChem CID 22964526) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-diazinane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,3-diazinane |
| PubChem CID | 22964526 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2,5-dimethyl-1,3-diazinane |
| SMILES | CC1CNC(C)NC1 |
| InChI | InChI=1S/C6H14N2/c1-5-3-7-6(2)8-4-5/h5-8H,3-4H2,1-2H3 |
| InChIKey | PXQRBGJTHKQWBC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,3-diazinane?
The IUPAC name of 2,5-dimethyl-1,3-diazinane (CID 22964526) is 2,5-dimethyl-1,3-diazinane.
What is the SMILES notation for 2,5-dimethyl-1,3-diazinane?
The canonical SMILES for 2,5-dimethyl-1,3-diazinane is CC1CNC(C)NC1.
What is the InChIKey of 2,5-dimethyl-1,3-diazinane?
The InChIKey is PXQRBGJTHKQWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-5-3-7-6(2)8-4-5/h5-8H,3-4H2,1-2H3.
What are the key properties of 2,5-dimethyl-1,3-diazinane?
2,5-dimethyl-1,3-diazinane has a molecular weight of 114.19 g/mol, XLogP of 0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,3-diazinane is sourced from PubChem (CID 22964526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).