C17H21BrClNO6S — CID 22964999
(2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-2-propan-2-ylsulfanyl-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 22964999) has the molecular formula C17H21BrClNO6S and a molecular weight of 482.78 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-2-propan-2-ylsulfanyl-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-2-propan-2-ylsulfanyl-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 22964999 |
| Molecular Formula | C17H21BrClNO6S |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-2-propan-2-ylsulfanyl-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)Sc1[nH]c2ccc(Br)c(Cl)c2c1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H21BrClNO6S/c1-6(2)27-16-15(10-8(20-16)4-3-7(18)11(10)19)26-17-14(24)13(23)12(22)9(5-21)25-17/h3-4,6,9,12-14,17,20-24H,5H2,1-2H3/t9-,12+,13+,14-,17+/m1/s1 |
| InChIKey | NBKOTIAXXVSXPM-OMWBYMHYSA-N |
| XLogP | 2.26 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |