About 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine
3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine (PubChem CID 2296510) has the molecular formula C13H19Cl2NO
and a molecular weight of 276.21 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine |
| PubChem CID | 2296510 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO/c1-3-16(4-2)8-5-9-17-11-6-7-12(14)13(15)10-11/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | OSUVDSBKOMZRNS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine?
The IUPAC name of 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine (CID 2296510) is 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine?
The canonical SMILES for 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine is CCN(CC)CCCOc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine?
The InChIKey is OSUVDSBKOMZRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2NO/c1-3-16(4-2)8-5-9-17-11-6-7-12(14)13(15)10-11/h6-7,10H,3-5,8-9H2,1-2H3.
What are the key properties of 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine?
3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine has a molecular weight of 276.21 g/mol, XLogP of 4.10, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenoxy)-N,N-diethylpropan-1-amine is sourced from PubChem (CID 2296510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).