C13H11ClF5N5 — CID 22965410
2-N-[1-(4-chlorophenyl)ethyl]-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 22965410) has the molecular formula C13H11ClF5N5 and a molecular weight of 367.71 g/mol. Its IUPAC name is 2-N-[1-(4-chlorophenyl)ethyl]-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[1-(4-chlorophenyl)ethyl]-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22965410 |
| Molecular Formula | C13H11ClF5N5 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-N-[1-(4-chlorophenyl)ethyl]-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Nc1nc(N)nc(C(F)(F)C(F)(F)F)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClF5N5/c1-6(7-2-4-8(14)5-3-7)21-11-23-9(22-10(20)24-11)12(15,16)13(17,18)19/h2-6H,1H3,(H3,20,21,22,23,24) |
| InChIKey | HBNFAUSRZNBLKP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|