C6H16N4 — CID 22965555
2-N,4,4-trimethylimidazolidine-1,2-diamine (PubChem CID 22965555) has the molecular formula C6H16N4 and a molecular weight of 144.22 g/mol. Its IUPAC name is 2-N,4,4-trimethylimidazolidine-1,2-diamine.
| Compound Name | 2-N,4,4-trimethylimidazolidine-1,2-diamine |
|---|---|
| PubChem CID | 22965555 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 2-N,4,4-trimethylimidazolidine-1,2-diamine |
| SMILES | CNC1NC(C)(C)CN1N |
| InChI | InChI=1S/C6H16N4/c1-6(2)4-10(7)5(8-3)9-6/h5,8-9H,4,7H2,1-3H3 |
| InChIKey | NHQSUIJGWJTTBD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|