About 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine
2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine (PubChem CID 22965558) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine |
| PubChem CID | 22965558 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine |
| SMILES | CN(C)C1=NCCN1N |
| InChI | InChI=1S/C5H12N4/c1-8(2)5-7-3-4-9(5)6/h3-4,6H2,1-2H3 |
| InChIKey | DTPVLIGUBZSJAH-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine?
The IUPAC name of 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine (CID 22965558) is 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine.
What is the SMILES notation for 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine?
The canonical SMILES for 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine is CN(C)C1=NCCN1N.
What is the InChIKey of 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine?
The InChIKey is DTPVLIGUBZSJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4/c1-8(2)5-7-3-4-9(5)6/h3-4,6H2,1-2H3.
What are the key properties of 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine?
2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine has a molecular weight of 128.18 g/mol, XLogP of -0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethyl-4,5-dihydroimidazole-1,2-diamine is sourced from PubChem (CID 22965558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).